C21H18O3 — CID 102593358
(4R,5R,6R)-4-(furan-2-yl)-5,6-diphenyloxan-2-one (PubChem CID 102593358) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is (4R,5R,6R)-4-(furan-2-yl)-5,6-diphenyloxan-2-one.
| Compound Name | (4R,5R,6R)-4-(furan-2-yl)-5,6-diphenyloxan-2-one |
|---|---|
| PubChem CID | 102593358 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (4R,5R,6R)-4-(furan-2-yl)-5,6-diphenyloxan-2-one |
| SMILES | O=C1C[C@@H](c2ccco2)[C@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C21H18O3/c22-19-14-17(18-12-7-13-23-18)20(15-8-3-1-4-9-15)21(24-19)16-10-5-2-6-11-16/h1-13,17,20-21H,14H2/t17-,20-,21-/m0/s1 |
| InChIKey | OMADXDDRCTYUIP-YYWHXJBOSA-N |
| XLogP | 4.84 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |