C10H10O3 — CID 101079486
cis-(1R,2R)-2-(furan-2-yl)-4-oxocyclopentane-1-carbaldehyde (PubChem CID 101079486) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is cis-(1R,2R)-2-(furan-2-yl)-4-oxocyclopentane-1-carbaldehyde.
| Compound Name | cis-(1R,2R)-2-(furan-2-yl)-4-oxocyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 101079486 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | cis-(1R,2R)-2-(furan-2-yl)-4-oxocyclopentane-1-carbaldehyde |
| SMILES | O=C[C@@H]1CC(=O)C[C@H]1c1ccco1 |
| InChI | InChI=1S/C10H10O3/c11-6-7-4-8(12)5-9(7)10-2-1-3-13-10/h1-3,6-7,9H,4-5H2/t7-,9+/m0/s1 |
| InChIKey | PFPVGFGEDGZPOC-IONNQARKSA-N |
| XLogP | 1.54 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|