C18H17NO6 — CID 91343396
(4-methoxycarbonylphenyl) (3R,4R)-3-formyl-4-(furan-2-yl)pyrrolidine-1-carboxylate (PubChem CID 91343396) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) (3R,4R)-3-formyl-4-(furan-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) (3R,4R)-3-formyl-4-(furan-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91343396 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (4-methoxycarbonylphenyl) (3R,4R)-3-formyl-4-(furan-2-yl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)N2C[C@H](c3ccco3)[C@@H](C=O)C2)cc1 |
| InChI | InChI=1S/C18H17NO6/c1-23-17(21)12-4-6-14(7-5-12)25-18(22)19-9-13(11-20)15(10-19)16-3-2-8-24-16/h2-8,11,13,15H,9-10H2,1H3/t13-,15+/m1/s1 |
| InChIKey | SLVAADAPMQTREN-HIFRSBDPSA-N |
| XLogP | 2.48 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|