C16H14ClNO4 — CID 86851547
methyl 4-chloro-3-[[2-(furan-2-yl)cyclopropanecarbonyl]amino]benzoate (PubChem CID 86851547) has the molecular formula C16H14ClNO4 and a molecular weight of 319.74 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(furan-2-yl)cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(furan-2-yl)cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 86851547 |
| Molecular Formula | C16H14ClNO4 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | methyl 4-chloro-3-[[2-(furan-2-yl)cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2CC2c2ccco2)c1 |
| InChI | InChI=1S/C16H14ClNO4/c1-21-16(20)9-4-5-12(17)13(7-9)18-15(19)11-8-10(11)14-3-2-6-22-14/h2-7,10-11H,8H2,1H3,(H,18,19) |
| InChIKey | QEQGLOFCGZPYPK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |