C19H23ClN2O4 — CID 109140447
methyl 4-chloro-3-[[2-(3-methylpiperidine-1-carbonyl)cyclopropanecarbonyl]amino]benzoate (PubChem CID 109140447) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(3-methylpiperidine-1-carbonyl)cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(3-methylpiperidine-1-carbonyl)cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109140447 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methyl 4-chloro-3-[[2-(3-methylpiperidine-1-carbonyl)cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2CC2C(=O)N2CCCC(C)C2)c1 |
| InChI | InChI=1S/C19H23ClN2O4/c1-11-4-3-7-22(10-11)18(24)14-9-13(14)17(23)21-16-8-12(19(25)26-2)5-6-15(16)20/h5-6,8,11,13-14H,3-4,7,9-10H2,1-2H3,(H,21,23) |
| InChIKey | IPEKTUAOKRPGQH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |