C18H24ClN3O4 — CID 113008037
methyl 4-chloro-3-[[1-(propan-2-ylcarbamoyl)piperidine-4-carbonyl]amino]benzoate (PubChem CID 113008037) has the molecular formula C18H24ClN3O4 and a molecular weight of 381.86 g/mol. Its IUPAC name is methyl 4-chloro-3-[[1-(propan-2-ylcarbamoyl)piperidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[1-(propan-2-ylcarbamoyl)piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113008037 |
| Molecular Formula | C18H24ClN3O4 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | methyl 4-chloro-3-[[1-(propan-2-ylcarbamoyl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2CCN(C(=O)NC(C)C)CC2)c1 |
| InChI | InChI=1S/C18H24ClN3O4/c1-11(2)20-18(25)22-8-6-12(7-9-22)16(23)21-15-10-13(17(24)26-3)4-5-14(15)19/h4-5,10-12H,6-9H2,1-3H3,(H,20,25)(H,21,23) |
| InChIKey | GEWHYMSPPMAOAO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |