C19H25ClN2O4 — CID 113008032
methyl 4-chloro-3-[[1-(3-methylbutanoyl)piperidine-4-carbonyl]amino]benzoate (PubChem CID 113008032) has the molecular formula C19H25ClN2O4 and a molecular weight of 380.87 g/mol. Its IUPAC name is methyl 4-chloro-3-[[1-(3-methylbutanoyl)piperidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[1-(3-methylbutanoyl)piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113008032 |
| Molecular Formula | C19H25ClN2O4 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | methyl 4-chloro-3-[[1-(3-methylbutanoyl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2CCN(C(=O)CC(C)C)CC2)c1 |
| InChI | InChI=1S/C19H25ClN2O4/c1-12(2)10-17(23)22-8-6-13(7-9-22)18(24)21-16-11-14(19(25)26-3)4-5-15(16)20/h4-5,11-13H,6-10H2,1-3H3,(H,21,24) |
| InChIKey | OHWVDIQFGKMTCJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |