C14H16ClNO5S — CID 110861821
methyl 4-chloro-3-[(1,1-dioxothiane-4-carbonyl)amino]benzoate (PubChem CID 110861821) has the molecular formula C14H16ClNO5S and a molecular weight of 345.80 g/mol. Its IUPAC name is methyl 4-chloro-3-[(1,1-dioxothiane-4-carbonyl)amino]benzoate.
| Compound Name | methyl 4-chloro-3-[(1,1-dioxothiane-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110861821 |
| Molecular Formula | C14H16ClNO5S |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | methyl 4-chloro-3-[(1,1-dioxothiane-4-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C14H16ClNO5S/c1-21-14(18)10-2-3-11(15)12(8-10)16-13(17)9-4-6-22(19,20)7-5-9/h2-3,8-9H,4-7H2,1H3,(H,16,17) |
| InChIKey | IEHXXWSBUOGOKQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |