C11H12O2 — CID 549488
cyclopropyl-[2-(furan-2-yl)cyclopropyl]methanone (PubChem CID 549488) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is cyclopropyl-[2-(furan-2-yl)cyclopropyl]methanone.
| Compound Name | cyclopropyl-[2-(furan-2-yl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 549488 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | cyclopropyl-[2-(furan-2-yl)cyclopropyl]methanone |
| SMILES | O=C(C1CC1)C1CC1c1ccco1 |
| InChI | InChI=1S/C11H12O2/c12-11(7-3-4-7)9-6-8(9)10-2-1-5-13-10/h1-2,5,7-9H,3-4,6H2 |
| InChIKey | NYMQECFYOUIGQV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |