C14H16N4O2 — CID 94215656
cis-(1S,2R)-N'-(4,6-dimethylpyrimidin-2-yl)-2-(furan-2-yl)cyclopropane-1-carbohydrazide (PubChem CID 94215656) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is cis-(1S,2R)-N'-(4,6-dimethylpyrimidin-2-yl)-2-(furan-2-yl)cyclopropane-1-carbohydrazide.
| Compound Name | cis-(1S,2R)-N'-(4,6-dimethylpyrimidin-2-yl)-2-(furan-2-yl)cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 94215656 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | cis-(1S,2R)-N'-(4,6-dimethylpyrimidin-2-yl)-2-(furan-2-yl)cyclopropane-1-carbohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)[C@H]2C[C@H]2c2ccco2)n1 |
| InChI | InChI=1S/C14H16N4O2/c1-8-6-9(2)16-14(15-8)18-17-13(19)11-7-10(11)12-4-3-5-20-12/h3-6,10-11H,7H2,1-2H3,(H,17,19)(H,15,16,18)/t10-,11+/m1/s1 |
| InChIKey | DNZNBYFNDOAHON-MNOVXSKESA-N |
| XLogP | 1.93 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|