C17H17F3N4O — CID 97004714
cis-(1R,2S)-N'-(4,6-dimethylpyrimidin-2-yl)-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carbohydrazide (PubChem CID 97004714) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is cis-(1R,2S)-N'-(4,6-dimethylpyrimidin-2-yl)-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carbohydrazide.
| Compound Name | cis-(1R,2S)-N'-(4,6-dimethylpyrimidin-2-yl)-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 97004714 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | cis-(1R,2S)-N'-(4,6-dimethylpyrimidin-2-yl)-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carbohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)[C@@H]2C[C@@H]2c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C17H17F3N4O/c1-9-7-10(2)22-16(21-9)24-23-15(25)13-8-12(13)11-5-3-4-6-14(11)17(18,19)20/h3-7,12-13H,8H2,1-2H3,(H,23,25)(H,21,22,24)/t12-,13-/m1/s1 |
| InChIKey | RHZWIQKELBXCDD-CHWSQXEVSA-N |
| XLogP | 3.36 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|