C21H18F3N3O2 — CID 134009766
1-methyl-N'-[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]indole-3-carbohydrazide (PubChem CID 134009766) has the molecular formula C21H18F3N3O2 and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-methyl-N'-[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]indole-3-carbohydrazide.
| Compound Name | 1-methyl-N'-[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]indole-3-carbohydrazide |
|---|---|
| PubChem CID | 134009766 |
| Molecular Formula | C21H18F3N3O2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-methyl-N'-[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]indole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)C2CC2c2ccccc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C21H18F3N3O2/c1-27-11-16(13-7-3-5-9-18(13)27)20(29)26-25-19(28)15-10-14(15)12-6-2-4-8-17(12)21(22,23)24/h2-9,11,14-15H,10H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | IUSWRSXVGWZYTB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|