C18H14BrF3N2O2 — CID 78832337
4-bromo-N'-[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]benzohydrazide (PubChem CID 78832337) has the molecular formula C18H14BrF3N2O2 and a molecular weight of 427.22 g/mol. Its IUPAC name is 4-bromo-N'-[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]benzohydrazide |
|---|---|
| PubChem CID | 78832337 |
| Molecular Formula | C18H14BrF3N2O2 |
| Molecular Weight | 427.22 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 4-bromo-N'-[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]benzohydrazide |
| SMILES | O=C(NNC(=O)C1CC1c1ccccc1C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H14BrF3N2O2/c19-11-7-5-10(6-8-11)16(25)23-24-17(26)14-9-13(14)12-3-1-2-4-15(12)18(20,21)22/h1-8,13-14H,9H2,(H,23,25)(H,24,26) |
| InChIKey | QKZXASXDHPDHBY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|