About 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide
4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide (PubChem CID 27663274) has the molecular formula C12H13BrN2O2
and a molecular weight of 297.15 g/mol. Its IUPAC name is 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide.
Molecular Properties
| Compound Name | 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide |
| PubChem CID | 27663274 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide |
| SMILES | C[C@H]1C[C@@H]1C(=O)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrN2O2/c1-7-6-10(7)12(17)15-14-11(16)8-2-4-9(13)5-3-8/h2-5,7,10H,6H2,1H3,(H,14,16)(H,15,17)/t7-,10-/m0/s1 |
| InChIKey | HPAIGOCGEIBNLL-XVKPBYJWSA-N |
| XLogP | 1.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide?
The IUPAC name of 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide (CID 27663274) is 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide.
What is the SMILES notation for 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide?
The canonical SMILES for 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide is C[C@H]1C[C@@H]1C(=O)NNC(=O)c1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide?
The InChIKey is HPAIGOCGEIBNLL-XVKPBYJWSA-N. The full InChI is InChI=1S/C12H13BrN2O2/c1-7-6-10(7)12(17)15-14-11(16)8-2-4-9(13)5-3-8/h2-5,7,10H,6H2,1H3,(H,14,16)(H,15,17)/t7-,10-/m0/s1.
What are the key properties of 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide?
4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide has a molecular weight of 297.15 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N'-[(1S,2S)-2-methylcyclopropanecarbonyl]benzohydrazide is sourced from PubChem (CID 27663274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).