C12H18O2 — CID 62999043
2-(furan-2-ylmethyl)cycloheptan-1-ol (PubChem CID 62999043) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)cycloheptan-1-ol.
| Compound Name | 2-(furan-2-ylmethyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 62999043 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-(furan-2-ylmethyl)cycloheptan-1-ol |
| SMILES | OC1CCCCCC1Cc1ccco1 |
| InChI | InChI=1S/C12H18O2/c13-12-7-3-1-2-5-10(12)9-11-6-4-8-14-11/h4,6,8,10,12-13H,1-3,5,7,9H2 |
| InChIKey | RJPOJFXFLQKVIA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |