C20H25NO2 — CID 40505929
N-[(1R,2R)-2-(furan-2-ylmethyl)cyclohexyl]-3-phenylpropanamide (PubChem CID 40505929) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is N-[(1R,2R)-2-(furan-2-ylmethyl)cyclohexyl]-3-phenylpropanamide.
| Compound Name | N-[(1R,2R)-2-(furan-2-ylmethyl)cyclohexyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 40505929 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-[(1R,2R)-2-(furan-2-ylmethyl)cyclohexyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)N[C@@H]1CCCC[C@@H]1Cc1ccco1 |
| InChI | InChI=1S/C20H25NO2/c22-20(13-12-16-7-2-1-3-8-16)21-19-11-5-4-9-17(19)15-18-10-6-14-23-18/h1-3,6-8,10,14,17,19H,4-5,9,11-13,15H2,(H,21,22)/t17-,19-/m1/s1 |
| InChIKey | VOQVDQFARQUJTM-IEBWSBKVSA-N |
| XLogP | 4.13 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |