C17H22N2O2 — CID 97228729
trans-(1S,2S)-N-(cyanomethyl)-N-cycloheptyl-2-(furan-2-yl)cyclopropane-1-carboxamide (PubChem CID 97228729) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is trans-(1S,2S)-N-(cyanomethyl)-N-cycloheptyl-2-(furan-2-yl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-(cyanomethyl)-N-cycloheptyl-2-(furan-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 97228729 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | trans-(1S,2S)-N-(cyanomethyl)-N-cycloheptyl-2-(furan-2-yl)cyclopropane-1-carboxamide |
| SMILES | N#CCN(C(=O)[C@H]1C[C@@H]1c1ccco1)C1CCCCCC1 |
| InChI | InChI=1S/C17H22N2O2/c18-9-10-19(13-6-3-1-2-4-7-13)17(20)15-12-14(15)16-8-5-11-21-16/h5,8,11,13-15H,1-4,6-7,10,12H2/t14-,15-/m0/s1 |
| InChIKey | UJMJCWLGBDJNJL-GJZGRUSLSA-N |
| XLogP | 3.46 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|