C17H21NO2 — CID 46868717
N-[(1R,2S)-2-(furan-2-yl)cyclohexyl]-4-methoxyaniline (PubChem CID 46868717) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[(1R,2S)-2-(furan-2-yl)cyclohexyl]-4-methoxyaniline.
| Compound Name | N-[(1R,2S)-2-(furan-2-yl)cyclohexyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 46868717 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N-[(1R,2S)-2-(furan-2-yl)cyclohexyl]-4-methoxyaniline |
| SMILES | COc1ccc(N[C@@H]2CCCC[C@@H]2c2ccco2)cc1 |
| InChI | InChI=1S/C17H21NO2/c1-19-14-10-8-13(9-11-14)18-16-6-3-2-5-15(16)17-7-4-12-20-17/h4,7-12,15-16,18H,2-3,5-6H2,1H3/t15-,16+/m0/s1 |
| InChIKey | YGCXZUVBWANNOC-JKSUJKDBSA-N |
| XLogP | 4.43 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|