C11H16O3 — CID 130831333
(2S,3R,4R,6S)-2-(furan-2-yl)-3,6-dimethyloxan-4-ol (PubChem CID 130831333) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2S,3R,4R,6S)-2-(furan-2-yl)-3,6-dimethyloxan-4-ol.
| Compound Name | (2S,3R,4R,6S)-2-(furan-2-yl)-3,6-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 130831333 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2S,3R,4R,6S)-2-(furan-2-yl)-3,6-dimethyloxan-4-ol |
| SMILES | C[C@@H]1[C@H](O)C[C@H](C)O[C@@H]1c1ccco1 |
| InChI | InChI=1S/C11H16O3/c1-7-6-9(12)8(2)11(14-7)10-4-3-5-13-10/h3-5,7-9,11-12H,6H2,1-2H3/t7-,8+,9+,11-/m0/s1 |
| InChIKey | NXWMTNUJFMJJKM-SJQPAMGKSA-N |
| XLogP | 2.13 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |