C15H20O2 — CID 6546148
(1S,4R,5S,8R,9S)-4-(furan-2-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-ene (PubChem CID 6546148) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1S,4R,5S,8R,9S)-4-(furan-2-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-ene.
| Compound Name | (1S,4R,5S,8R,9S)-4-(furan-2-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 6546148 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1S,4R,5S,8R,9S)-4-(furan-2-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-ene |
| SMILES | CC1=C[C@@H](C)[C@@H]2CO[C@@H](c3ccco3)[C@H]1[C@H]2C |
| InChI | InChI=1S/C15H20O2/c1-9-7-10(2)14-11(3)12(9)8-17-15(14)13-5-4-6-16-13/h4-7,9,11-12,14-15H,8H2,1-3H3/t9-,11+,12+,14-,15+/m1/s1 |
| InChIKey | KGXZCJHFZYYKMQ-ONAWRNRTSA-N |
| XLogP | 3.82 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|