C19H26O — CID 11873039
(1R,4R,5R,8R,9S)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-ene (PubChem CID 11873039) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is (1R,4R,5R,8R,9S)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-ene.
| Compound Name | (1R,4R,5R,8R,9S)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 11873039 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (1R,4R,5R,8R,9S)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-ene |
| SMILES | CC1=C[C@@H](C)[C@H]2CO[C@H](CCc3ccccc3)[C@@H]1[C@H]2C |
| InChI | InChI=1S/C19H26O/c1-13-11-14(2)19-15(3)17(13)12-20-18(19)10-9-16-7-5-4-6-8-16/h4-8,11,13,15,17-19H,9-10,12H2,1-3H3/t13-,15+,17-,18-,19+/m1/s1 |
| InChIKey | UVNGGCOBGXQNNU-UZJLFSMRSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|