C17H22O — CID 40595801
(1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-phenyl-3-oxabicyclo[3.3.1]non-6-ene (PubChem CID 40595801) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-phenyl-3-oxabicyclo[3.3.1]non-6-ene.
| Compound Name | (1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-phenyl-3-oxabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 40595801 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-phenyl-3-oxabicyclo[3.3.1]non-6-ene |
| SMILES | CC1=C[C@H](C)[C@H]2CO[C@H](c3ccccc3)[C@@H]1[C@@H]2C |
| InChI | InChI=1S/C17H22O/c1-11-9-12(2)16-13(3)15(11)10-18-17(16)14-7-5-4-6-8-14/h4-9,11,13,15-17H,10H2,1-3H3/t11-,13+,15+,16-,17+/m0/s1 |
| InChIKey | NNHYOOCXPLESAS-SGXQQNEYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|