About methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate
methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate (PubChem CID 15437551) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate.
Analyze methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate?
The IUPAC name of methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate (CID 15437551) is methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate.
What is the SMILES notation for methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate?
The canonical SMILES for methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate is COC(=O)C1(C)OCCOC1c1ccco1.
What is the InChIKey of methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate?
The InChIKey is SEVHLJJYMXTZTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5/c1-11(10(12)13-2)9(15-6-7-16-11)8-4-3-5-14-8/h3-5,9H,6-7H2,1-2H3.
What are the key properties of methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate?
methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate has a molecular weight of 226.23 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(furan-2-yl)-2-methyl-1,4-dioxane-2-carboxylate is sourced from PubChem (CID 15437551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).