C14H17N2O5+ — CID 7400057
methyl (1R,3S,3aR,6aS)-1-(furan-2-yl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 7400057) has the molecular formula C14H17N2O5+ and a molecular weight of 293.30 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-1-(furan-2-yl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-1-(furan-2-yl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 7400057 |
| Molecular Formula | C14H17N2O5+ |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-1-(furan-2-yl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)[NH2+][C@@H](c2ccco2)[C@H]2C(=O)N(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C14H16N2O5/c1-14(13(19)20-3)9-8(11(17)16(2)12(9)18)10(15-14)7-5-4-6-21-7/h4-6,8-10,15H,1-3H3/p+1/t8-,9-,10-,14-/m0/s1 |
| InChIKey | BQULDHJKWBKOJR-QSDJMHMYSA-O |
| XLogP | -0.94 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|