C16H21N2O5+ — CID 11901838
ethyl (1R,3R,3aR,6aS)-5-ethyl-1-(furan-2-yl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 11901838) has the molecular formula C16H21N2O5+ and a molecular weight of 321.35 g/mol. Its IUPAC name is ethyl (1R,3R,3aR,6aS)-5-ethyl-1-(furan-2-yl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | ethyl (1R,3R,3aR,6aS)-5-ethyl-1-(furan-2-yl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 11901838 |
| Molecular Formula | C16H21N2O5+ |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | ethyl (1R,3R,3aR,6aS)-5-ethyl-1-(furan-2-yl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)[NH2+][C@@H](c2ccco2)[C@H]2C(=O)N(CC)C(=O)[C@H]21 |
| InChI | InChI=1S/C16H20N2O5/c1-4-18-13(19)10-11(14(18)20)16(3,15(21)22-5-2)17-12(10)9-7-6-8-23-9/h6-8,10-12,17H,4-5H2,1-3H3/p+1/t10-,11-,12-,16+/m0/s1 |
| InChIKey | PVFHPTHINWHKPS-CENBSLRLSA-O |
| XLogP | -0.16 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|