C18H25N2O5S+ — CID 11891128
ethyl (1S,3R,3aR,6aR)-5-ethyl-1-(furan-2-yl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 11891128) has the molecular formula C18H25N2O5S+ and a molecular weight of 381.47 g/mol. Its IUPAC name is ethyl (1S,3R,3aR,6aR)-5-ethyl-1-(furan-2-yl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | ethyl (1S,3R,3aR,6aR)-5-ethyl-1-(furan-2-yl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 11891128 |
| Molecular Formula | C18H25N2O5S+ |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | ethyl (1S,3R,3aR,6aR)-5-ethyl-1-(furan-2-yl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(CCSC)[NH2+][C@H](c2ccco2)[C@@H]2C(=O)N(CC)C(=O)[C@H]21 |
| InChI | InChI=1S/C18H24N2O5S/c1-4-20-15(21)12-13(16(20)22)18(8-10-26-3,17(23)24-5-2)19-14(12)11-7-6-9-25-11/h6-7,9,12-14,19H,4-5,8,10H2,1-3H3/p+1/t12-,13+,14-,18-/m1/s1 |
| InChIKey | IDDFSPWSCZSHEQ-KYZVSKTDSA-O |
| XLogP | 0.57 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|