C18H22N2O5S — CID 11893281
(1S,3R,3aR,6aS)-5-ethyl-1-(2-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 11893281) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is (1S,3R,3aR,6aS)-5-ethyl-1-(2-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | (1S,3R,3aR,6aS)-5-ethyl-1-(2-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 11893281 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (1S,3R,3aR,6aS)-5-ethyl-1-(2-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | CCN1C(=O)[C@@H]2[C@@H](c3ccccc3O)[NH2+][C@@](CCSC)(C(=O)[O-])[C@@H]2C1=O |
| InChI | InChI=1S/C18H22N2O5S/c1-3-20-15(22)12-13(16(20)23)18(17(24)25,8-9-26-2)19-14(12)10-6-4-5-7-11(10)21/h4-7,12-14,19,21H,3,8-9H2,1-2H3,(H,24,25)/t12-,13-,14+,18+/m0/s1 |
| InChIKey | GPLDLWKDASQXAC-UYAYXHRUSA-N |
| XLogP | -1.13 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|