C19H24FN2O4S+ — CID 11902136
methyl (1R,3R,3aR,6aR)-5-ethyl-1-(3-fluorophenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 11902136) has the molecular formula C19H24FN2O4S+ and a molecular weight of 395.48 g/mol. Its IUPAC name is methyl (1R,3R,3aR,6aR)-5-ethyl-1-(3-fluorophenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | methyl (1R,3R,3aR,6aR)-5-ethyl-1-(3-fluorophenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 11902136 |
| Molecular Formula | C19H24FN2O4S+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | methyl (1R,3R,3aR,6aR)-5-ethyl-1-(3-fluorophenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | CCN1C(=O)[C@@H]2[C@@H](C1=O)[C@](CCSC)(C(=O)OC)[NH2+][C@H]2c1cccc(F)c1 |
| InChI | InChI=1S/C19H23FN2O4S/c1-4-22-16(23)13-14(17(22)24)19(8-9-27-3,18(25)26-2)21-15(13)11-6-5-7-12(20)10-11/h5-7,10,13-15,21H,4,8-9H2,1-3H3/p+1/t13-,14+,15+,19-/m1/s1 |
| InChIKey | AYCXMYDGNJEDLS-MMMWYMCRSA-O |
| XLogP | 0.73 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|