C19H25N2O5S+ — CID 11901758
methyl (1R,3R,3aR,6aS)-1-(4-methoxyphenyl)-5-methyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 11901758) has the molecular formula C19H25N2O5S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is methyl (1R,3R,3aR,6aS)-1-(4-methoxyphenyl)-5-methyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | methyl (1R,3R,3aR,6aS)-1-(4-methoxyphenyl)-5-methyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 11901758 |
| Molecular Formula | C19H25N2O5S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | methyl (1R,3R,3aR,6aS)-1-(4-methoxyphenyl)-5-methyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | COC(=O)[C@]1(CCSC)[NH2+][C@@H](c2ccc(OC)cc2)[C@H]2C(=O)N(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C19H24N2O5S/c1-21-16(22)13-14(17(21)23)19(9-10-27-4,18(24)26-3)20-15(13)11-5-7-12(25-2)8-6-11/h5-8,13-15,20H,9-10H2,1-4H3/p+1/t13-,14-,15-,19+/m0/s1 |
| InChIKey | IUSUOKFZPLYYSU-XMDUPGNXSA-O |
| XLogP | 0.21 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|