C16H21N2O5S+ — CID 11901718
methyl (1R,3R,3aR,6aS)-1-(furan-2-yl)-5-methyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 11901718) has the molecular formula C16H21N2O5S+ and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl (1R,3R,3aR,6aS)-1-(furan-2-yl)-5-methyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | methyl (1R,3R,3aR,6aS)-1-(furan-2-yl)-5-methyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 11901718 |
| Molecular Formula | C16H21N2O5S+ |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | methyl (1R,3R,3aR,6aS)-1-(furan-2-yl)-5-methyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | COC(=O)[C@]1(CCSC)[NH2+][C@@H](c2ccco2)[C@H]2C(=O)N(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C16H20N2O5S/c1-18-13(19)10-11(14(18)20)16(6-8-24-3,15(21)22-2)17-12(10)9-5-4-7-23-9/h4-5,7,10-12,17H,6,8H2,1-3H3/p+1/t10-,11-,12-,16+/m0/s1 |
| InChIKey | WDARWSXAQTXDTN-CENBSLRLSA-O |
| XLogP | -0.21 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|