C17H23N2O5+ — CID 7400519
ethyl (1R,3S,3aS,6aS)-1-(furan-2-yl)-5-methyl-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 7400519) has the molecular formula C17H23N2O5+ and a molecular weight of 335.38 g/mol. Its IUPAC name is ethyl (1R,3S,3aS,6aS)-1-(furan-2-yl)-5-methyl-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | ethyl (1R,3S,3aS,6aS)-1-(furan-2-yl)-5-methyl-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 7400519 |
| Molecular Formula | C17H23N2O5+ |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | ethyl (1R,3S,3aS,6aS)-1-(furan-2-yl)-5-methyl-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | CCC[C@]1(C(=O)OCC)[NH2+][C@@H](c2ccco2)[C@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C17H22N2O5/c1-4-8-17(16(22)23-5-2)12-11(14(20)19(3)15(12)21)13(18-17)10-7-6-9-24-10/h6-7,9,11-13,18H,4-5,8H2,1-3H3/p+1/t11-,12+,13-,17-/m0/s1 |
| InChIKey | NLZNOCHSXSJILW-LKQDWFRTSA-O |
| XLogP | 0.23 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|