C14H16O5 — CID 10683010
methyl (1S,2S,4S,5S)-2-(furan-2-yl)-4-hydroxy-8-oxobicyclo[3.2.1]octane-1-carboxylate (PubChem CID 10683010) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl (1S,2S,4S,5S)-2-(furan-2-yl)-4-hydroxy-8-oxobicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | methyl (1S,2S,4S,5S)-2-(furan-2-yl)-4-hydroxy-8-oxobicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 10683010 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | methyl (1S,2S,4S,5S)-2-(furan-2-yl)-4-hydroxy-8-oxobicyclo[3.2.1]octane-1-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@H](C1=O)[C@@H](O)C[C@@H]2c1ccco1 |
| InChI | InChI=1S/C14H16O5/c1-18-13(17)14-5-4-8(12(14)16)10(15)7-9(14)11-3-2-6-19-11/h2-3,6,8-10,15H,4-5,7H2,1H3/t8-,9+,10-,14-/m0/s1 |
| InChIKey | VNVZQFGDMLVELZ-JIXVBMEVSA-N |
| XLogP | 1.27 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|