C16H14O5 — CID 102596315
methyl (1R,2R)-2-(furan-2-carbonyl)-1-hydroxy-1,3-dihydroindene-2-carboxylate (PubChem CID 102596315) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is methyl (1R,2R)-2-(furan-2-carbonyl)-1-hydroxy-1,3-dihydroindene-2-carboxylate.
| Compound Name | methyl (1R,2R)-2-(furan-2-carbonyl)-1-hydroxy-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 102596315 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl (1R,2R)-2-(furan-2-carbonyl)-1-hydroxy-1,3-dihydroindene-2-carboxylate |
| SMILES | COC(=O)[C@]1(C(=O)c2ccco2)Cc2ccccc2[C@H]1O |
| InChI | InChI=1S/C16H14O5/c1-20-15(19)16(14(18)12-7-4-8-21-12)9-10-5-2-3-6-11(10)13(16)17/h2-8,13,17H,9H2,1H3/t13-,16-/m1/s1 |
| InChIKey | BIDAMPNUFMDWTR-CZUORRHYSA-N |
| XLogP | 1.91 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|