C22H31NO4 — CID 102129697
dimethyl 1-(2,6-dimethylhept-5-en-2-ylamino)-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 102129697) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is dimethyl 1-(2,6-dimethylhept-5-en-2-ylamino)-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 1-(2,6-dimethylhept-5-en-2-ylamino)-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102129697 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | dimethyl 1-(2,6-dimethylhept-5-en-2-ylamino)-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2C1NC(C)(C)CCC=C(C)C |
| InChI | InChI=1S/C22H31NO4/c1-15(2)10-9-13-21(3,4)23-18-17-12-8-7-11-16(17)14-22(18,19(24)26-5)20(25)27-6/h7-8,10-12,18,23H,9,13-14H2,1-6H3 |
| InChIKey | PHSJQTUTMQRQRU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|