C14H12BrNO2 — CID 114312884
N-(2-bromo-2,3-dihydro-1H-inden-1-yl)furan-2-carboxamide (PubChem CID 114312884) has the molecular formula C14H12BrNO2 and a molecular weight of 306.16 g/mol. Its IUPAC name is N-(2-bromo-2,3-dihydro-1H-inden-1-yl)furan-2-carboxamide.
| Compound Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 114312884 |
| Molecular Formula | C14H12BrNO2 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)furan-2-carboxamide |
| SMILES | O=C(NC1c2ccccc2CC1Br)c1ccco1 |
| InChI | InChI=1S/C14H12BrNO2/c15-11-8-9-4-1-2-5-10(9)13(11)16-14(17)12-6-3-7-18-12/h1-7,11,13H,8H2,(H,16,17) |
| InChIKey | AOZISBQOOLQJGR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|