C16H16BrNOS — CID 114312817
N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-5-ethylthiophene-2-carboxamide (PubChem CID 114312817) has the molecular formula C16H16BrNOS and a molecular weight of 350.28 g/mol. Its IUPAC name is N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-5-ethylthiophene-2-carboxamide.
| Compound Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-5-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 114312817 |
| Molecular Formula | C16H16BrNOS |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-5-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NC2c3ccccc3CC2Br)s1 |
| InChI | InChI=1S/C16H16BrNOS/c1-2-11-7-8-14(20-11)16(19)18-15-12-6-4-3-5-10(12)9-13(15)17/h3-8,13,15H,2,9H2,1H3,(H,18,19) |
| InChIKey | LHFMUDQPOJCGNZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|