C16H13BrINO — CID 114312900
N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-3-iodobenzamide (PubChem CID 114312900) has the molecular formula C16H13BrINO and a molecular weight of 442.09 g/mol. Its IUPAC name is N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-3-iodobenzamide.
| Compound Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-3-iodobenzamide |
|---|---|
| PubChem CID | 114312900 |
| Molecular Formula | C16H13BrINO |
| Molecular Weight | 442.09 g/mol |
| Exact Mass | 440.92 |
| IUPAC Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-3-iodobenzamide |
| SMILES | O=C(NC1c2ccccc2CC1Br)c1cccc(I)c1 |
| InChI | InChI=1S/C16H13BrINO/c17-14-9-10-4-1-2-7-13(10)15(14)19-16(20)11-5-3-6-12(18)8-11/h1-8,14-15H,9H2,(H,19,20) |
| InChIKey | FMWFGJKCBMAOHX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|