C14H11BrINOS — CID 114312765
N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-5-iodothiophene-3-carboxamide (PubChem CID 114312765) has the molecular formula C14H11BrINOS and a molecular weight of 448.12 g/mol. Its IUPAC name is N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 114312765 |
| Molecular Formula | C14H11BrINOS |
| Molecular Weight | 448.12 g/mol |
| Exact Mass | 446.88 |
| IUPAC Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-5-iodothiophene-3-carboxamide |
| SMILES | O=C(NC1c2ccccc2CC1Br)c1csc(I)c1 |
| InChI | InChI=1S/C14H11BrINOS/c15-11-5-8-3-1-2-4-10(8)13(11)17-14(18)9-6-12(16)19-7-9/h1-4,6-7,11,13H,5H2,(H,17,18) |
| InChIKey | ZMDPMDLFJDEQIQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.12 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|