C15H20BrNO — CID 114312813
N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-4-methylpentanamide (PubChem CID 114312813) has the molecular formula C15H20BrNO and a molecular weight of 310.24 g/mol. Its IUPAC name is N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-4-methylpentanamide.
| Compound Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 114312813 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(2-bromo-2,3-dihydro-1H-inden-1-yl)-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NC1c2ccccc2CC1Br |
| InChI | InChI=1S/C15H20BrNO/c1-10(2)7-8-14(18)17-15-12-6-4-3-5-11(12)9-13(15)16/h3-6,10,13,15H,7-9H2,1-2H3,(H,17,18) |
| InChIKey | VWSRMNKWLYQLEA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|