C10H12O4 — CID 13177121
ethyl 3-(furan-2-yl)-2-methyloxirane-2-carboxylate (PubChem CID 13177121) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is ethyl 3-(furan-2-yl)-2-methyloxirane-2-carboxylate.
| Compound Name | ethyl 3-(furan-2-yl)-2-methyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 13177121 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | ethyl 3-(furan-2-yl)-2-methyloxirane-2-carboxylate |
| SMILES | CCOC(=O)C1(C)OC1c1ccco1 |
| InChI | InChI=1S/C10H12O4/c1-3-12-9(11)10(2)8(14-10)7-5-4-6-13-7/h4-6,8H,3H2,1-2H3 |
| InChIKey | AUXFNGIZIIPDIP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 51.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|