C19H22O5 — CID 137384255
trans-ethyl (2R,4R)-3-(1-ethoxyethenyl)-2,4-bis(furan-2-yl)cyclobutane-1-carboxylate (PubChem CID 137384255) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is trans-ethyl (2R,4R)-3-(1-ethoxyethenyl)-2,4-bis(furan-2-yl)cyclobutane-1-carboxylate.
| Compound Name | trans-ethyl (2R,4R)-3-(1-ethoxyethenyl)-2,4-bis(furan-2-yl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 137384255 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | trans-ethyl (2R,4R)-3-(1-ethoxyethenyl)-2,4-bis(furan-2-yl)cyclobutane-1-carboxylate |
| SMILES | C=C(OCC)C1[C@@H](c2ccco2)C(C(=O)OCC)[C@@H]1c1ccco1 |
| InChI | InChI=1S/C19H22O5/c1-4-21-12(3)15-16(13-8-6-10-23-13)18(19(20)22-5-2)17(15)14-9-7-11-24-14/h6-11,15-18H,3-5H2,1-2H3/t15?,16-,17-,18?/m1/s1 |
| InChIKey | PPKARRWZFUMGSE-QLOLRVAOSA-N |
| XLogP | 4.10 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|