C16H21NO4 — CID 170905934
ethyl 6-(furan-2-yl)-3-methyl-4-oxo-1,2,3,3a,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 170905934) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 6-(furan-2-yl)-3-methyl-4-oxo-1,2,3,3a,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | ethyl 6-(furan-2-yl)-3-methyl-4-oxo-1,2,3,3a,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 170905934 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethyl 6-(furan-2-yl)-3-methyl-4-oxo-1,2,3,3a,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | CCOC(=O)C1NC2CC(c3ccco3)CC(=O)C2C1C |
| InChI | InChI=1S/C16H21NO4/c1-3-20-16(19)15-9(2)14-11(17-15)7-10(8-12(14)18)13-5-4-6-21-13/h4-6,9-11,14-15,17H,3,7-8H2,1-2H3 |
| InChIKey | CMMFBBGHWOFTSS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |