C15H18N2O5 — CID 7422537
ethyl (4S,5R,6R)-4-(furan-2-yl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate (PubChem CID 7422537) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is ethyl (4S,5R,6R)-4-(furan-2-yl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate.
| Compound Name | ethyl (4S,5R,6R)-4-(furan-2-yl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 7422537 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | ethyl (4S,5R,6R)-4-(furan-2-yl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccco2)c2c([nH][nH]c2=O)C[C@@]1(C)O |
| InChI | InChI=1S/C15H18N2O5/c1-3-21-14(19)12-11(9-5-4-6-22-9)10-8(7-15(12,2)20)16-17-13(10)18/h4-6,11-12,20H,3,7H2,1-2H3,(H2,16,17,18)/t11-,12+,15-/m1/s1 |
| InChIKey | HORJLKMTPAQIGI-TYNCELHUSA-N |
| XLogP | 0.91 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |