C26H30N2O4 — CID 92670000
benzyl (4R,5R,6S)-4-(4-tert-butylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate (PubChem CID 92670000) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is benzyl (4R,5R,6S)-4-(4-tert-butylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate.
| Compound Name | benzyl (4R,5R,6S)-4-(4-tert-butylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 92670000 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | benzyl (4R,5R,6S)-4-(4-tert-butylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
| SMILES | CC(C)(C)c1ccc([C@@H]2c3c([nH][nH]c3=O)C[C@](C)(O)[C@@H]2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H30N2O4/c1-25(2,3)18-12-10-17(11-13-18)20-21-19(27-28-23(21)29)14-26(4,31)22(20)24(30)32-15-16-8-6-5-7-9-16/h5-13,20,22,31H,14-15H2,1-4H3,(H2,27,28,29)/t20-,22+,26+/m1/s1 |
| InChIKey | OZIJCCMDTWRUDG-QTISVLPJSA-N |
| XLogP | 3.80 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |