C12H15Cl2NO2 — CID 141236194
2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethylpyrrolidin-3-yl]ethanone (PubChem CID 141236194) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is 2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethylpyrrolidin-3-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethylpyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 141236194 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethylpyrrolidin-3-yl]ethanone |
| SMILES | CC1(C)NC(c2ccco2)CC1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C12H15Cl2NO2/c1-12(2)7(10(16)11(13)14)6-8(15-12)9-4-3-5-17-9/h3-5,7-8,11,15H,6H2,1-2H3 |
| InChIKey | SZGNKQUYGOMFQF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|