C15H17F3N4O2 — CID 822214
(5R,7R)-5-(furan-2-yl)-N-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 822214) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is (5R,7R)-5-(furan-2-yl)-N-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-5-(furan-2-yl)-N-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 822214 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (5R,7R)-5-(furan-2-yl)-N-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CC(C)NC(=O)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@H](c1ccco1)N2 |
| InChI | InChI=1S/C15H17F3N4O2/c1-8(2)19-14(23)10-7-13-20-9(11-4-3-5-24-11)6-12(15(16,17)18)22(13)21-10/h3-5,7-9,12,20H,6H2,1-2H3,(H,19,23)/t9-,12-/m1/s1 |
| InChIKey | PVUUAFFHDGPECU-BXKDBHETSA-N |
| XLogP | 3.27 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |