C16H19F3N4O2 — CID 3148192
N-butyl-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 3148192) has the molecular formula C16H19F3N4O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is N-butyl-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-butyl-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 3148192 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-butyl-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc2n(n1)C(C(F)(F)F)CC(c1ccco1)N2 |
| InChI | InChI=1S/C16H19F3N4O2/c1-2-3-6-20-15(24)11-9-14-21-10(12-5-4-7-25-12)8-13(16(17,18)19)23(14)22-11/h4-5,7,9-10,13,21H,2-3,6,8H2,1H3,(H,20,24) |
| InChIKey | ZUNFPACTIDWUOK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|