C9H12O4 — CID 101108105
3-(furan-2-yl)-6,6-dimethyl-1,2,4-trioxane (PubChem CID 101108105) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-(furan-2-yl)-6,6-dimethyl-1,2,4-trioxane.
| Compound Name | 3-(furan-2-yl)-6,6-dimethyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 101108105 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-(furan-2-yl)-6,6-dimethyl-1,2,4-trioxane |
| SMILES | CC1(C)COC(c2ccco2)OO1 |
| InChI | InChI=1S/C9H12O4/c1-9(2)6-11-8(12-13-9)7-4-3-5-10-7/h3-5,8H,6H2,1-2H3 |
| InChIKey | WYRZGNPPXUNAHV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|