C12H18O3 — CID 70895233
5-butan-2-yl-2-(furan-2-yl)-1,3-dioxane (PubChem CID 70895233) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 5-butan-2-yl-2-(furan-2-yl)-1,3-dioxane.
| Compound Name | 5-butan-2-yl-2-(furan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 70895233 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 5-butan-2-yl-2-(furan-2-yl)-1,3-dioxane |
| SMILES | CCC(C)C1COC(c2ccco2)OC1 |
| InChI | InChI=1S/C12H18O3/c1-3-9(2)10-7-14-12(15-8-10)11-5-4-6-13-11/h4-6,9-10,12H,3,7-8H2,1-2H3 |
| InChIKey | UDFCWAUAMJWKHX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |