C12H19NO — CID 81403177
1-cyclopropyl-N-[(1S)-1-(furan-2-yl)ethyl]propan-1-amine (PubChem CID 81403177) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(1S)-1-(furan-2-yl)ethyl]propan-1-amine.
| Compound Name | 1-cyclopropyl-N-[(1S)-1-(furan-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 81403177 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-cyclopropyl-N-[(1S)-1-(furan-2-yl)ethyl]propan-1-amine |
| SMILES | CCC(N[C@@H](C)c1ccco1)C1CC1 |
| InChI | InChI=1S/C12H19NO/c1-3-11(10-6-7-10)13-9(2)12-5-4-8-14-12/h4-5,8-11,13H,3,6-7H2,1-2H3/t9-,11?/m0/s1 |
| InChIKey | VONYDXKUKRDDNR-FTNKSUMCSA-N |
| XLogP | 3.12 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |